About CID 87755042
CID 87755042 (PubChem CID 87755042) has the molecular formula C5H10NOSSe
and a molecular weight of 211.17 g/mol.
Molecular Properties
| Compound Name | CID 87755042 |
| PubChem CID | 87755042 |
| Molecular Formula | C5H10NOSSe |
| Molecular Weight | 211.17 g/mol |
| Exact Mass | 211.96 |
| IUPAC Name | — |
| SMILES | CSCC[C@H](N)C(=O)[Se] |
| InChI | InChI=1S/C5H10NOSSe/c1-8-3-2-4(6)5(7)9/h4H,2-3,6H2,1H3/t4-/m0/s1 |
| InChIKey | KZGCCOWGSPNHKO-BYPYZUCNSA-N |
| XLogP | -0.24 |
| TPSA | 43.09 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 9 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 211.17 |
| LogP ≤ 5 | -0.24 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|
Analyze CID 87755042 with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of CID 87755042?
The IUPAC name of CID 87755042 (CID 87755042) is not available.
What is the SMILES notation for CID 87755042?
The canonical SMILES for CID 87755042 is CSCC[C@H](N)C(=O)[Se].
What is the InChIKey of CID 87755042?
The InChIKey is KZGCCOWGSPNHKO-BYPYZUCNSA-N. The full InChI is InChI=1S/C5H10NOSSe/c1-8-3-2-4(6)5(7)9/h4H,2-3,6H2,1H3/t4-/m0/s1.
What are the key properties of CID 87755042?
CID 87755042 has a molecular weight of 211.17 g/mol, XLogP of -0.24, 4 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for CID 87755042 is sourced from PubChem (CID 87755042), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).