C16H22N2 — CID 87755816
3-pentyl-2,3,3a,4-tetrahydro-1H-benzo[g]indazole (PubChem CID 87755816) has the molecular formula C16H22N2 and a molecular weight of 242.37 g/mol. Its IUPAC name is 3-pentyl-2,3,3a,4-tetrahydro-1H-benzo[g]indazole.
| Compound Name | 3-pentyl-2,3,3a,4-tetrahydro-1H-benzo[g]indazole |
|---|---|
| PubChem CID | 87755816 |
| Molecular Formula | C16H22N2 |
| Molecular Weight | 242.37 g/mol |
| Exact Mass | 242.18 |
| IUPAC Name | 3-pentyl-2,3,3a,4-tetrahydro-1H-benzo[g]indazole |
| SMILES | CCCCCC1NNC2=c3ccccc3=CCC21 |
| InChI | InChI=1S/C16H22N2/c1-2-3-4-9-15-14-11-10-12-7-5-6-8-13(12)16(14)18-17-15/h5-8,10,14-15,17-18H,2-4,9,11H2,1H3 |
| InChIKey | GQSVTNFRWNNRHZ-UHFFFAOYSA-N |
| XLogP | 1.65 |
| TPSA | 24.06 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 242.37 |
| LogP ≤ 5 | 1.65 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|