C33H25F3O2S — CID 87756148
3,3,3-trifluoro-2,2-diphenylpropanoate;triphenylsulfanium (PubChem CID 87756148) has the molecular formula C33H25F3O2S and a molecular weight of 542.62 g/mol. Its IUPAC name is 3,3,3-trifluoro-2,2-diphenylpropanoate;triphenylsulfanium.
| Compound Name | 3,3,3-trifluoro-2,2-diphenylpropanoate;triphenylsulfanium |
|---|---|
| PubChem CID | 87756148 |
| Molecular Formula | C33H25F3O2S |
| Molecular Weight | 542.62 g/mol |
| Exact Mass | 542.15 |
| IUPAC Name | 3,3,3-trifluoro-2,2-diphenylpropanoate;triphenylsulfanium |
| SMILES | O=C([O-])C(c1ccccc1)(c1ccccc1)C(F)(F)F.c1ccc([S+](c2ccccc2)c2ccccc2)cc1 |
| InChI | InChI=1S/C18H15S.C15H11F3O2/c1-4-10-16(11-5-1)19(17-12-6-2-7-13-17)18-14-8-3-9-15-18;16-15(17,18)14(13(19)20,11-7-3-1-4-8-11)12-9-5-2-6-10-12/h1-15H;1-10H,(H,19,20)/q+1;/p-1 |
| InChIKey | COLMRUPYFVFZKG-UHFFFAOYSA-M |
| XLogP | 7.07 |
| TPSA | 40.13 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 542.62 |
| LogP ≤ 5 | 7.07 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'charged_oxygen_or_sulfur_atoms', 'substructure': 'N/A'} |
|---|