C37H39F11O2S — CID 87756277
tris(4-tert-butylphenyl)sulfanium;1,2,2,3,3,4,4,5,5,6,6-undecafluorocyclohexane-1-carboxylate (PubChem CID 87756277) has the molecular formula C37H39F11O2S and a molecular weight of 756.76 g/mol. Its IUPAC name is tris(4-tert-butylphenyl)sulfanium;1,2,2,3,3,4,4,5,5,6,6-undecafluorocyclohexane-1-carboxylate.
| Compound Name | tris(4-tert-butylphenyl)sulfanium;1,2,2,3,3,4,4,5,5,6,6-undecafluorocyclohexane-1-carboxylate |
|---|---|
| PubChem CID | 87756277 |
| Molecular Formula | C37H39F11O2S |
| Molecular Weight | 756.76 g/mol |
| Exact Mass | 756.25 |
| IUPAC Name | tris(4-tert-butylphenyl)sulfanium;1,2,2,3,3,4,4,5,5,6,6-undecafluorocyclohexane-1-carboxylate |
| SMILES | CC(C)(C)c1ccc([S+](c2ccc(C(C)(C)C)cc2)c2ccc(C(C)(C)C)cc2)cc1.O=C([O-])C1(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)C1(F)F |
| InChI | InChI=1S/C30H39S.C7HF11O2/c1-28(2,3)22-10-16-25(17-11-22)31(26-18-12-23(13-19-26)29(4,5)6)27-20-14-24(15-21-27)30(7,8)9;8-2(1(19)20)3(9,10)5(13,14)7(17,18)6(15,16)4(2,11)12/h10-21H,1-9H3;(H,19,20)/q+1;/p-1 |
| InChIKey | XPXFDSCJLYKKNG-UHFFFAOYSA-M |
| XLogP | 10.31 |
| TPSA | 40.13 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 51 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 756.76 |
| LogP ≤ 5 | 10.31 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'charged_oxygen_or_sulfur_atoms', 'substructure': 'N/A'}, {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|