C37H39F11O2S — CID 87756279
[tris(4-tert-butylphenyl)-λ4-sulfanyl] 1,2,2,3,3,4,4,5,5,6,6-undecafluorocyclohexane-1-carboxylate (PubChem CID 87756279) has the molecular formula C37H39F11O2S and a molecular weight of 756.76 g/mol. Its IUPAC name is [tris(4-tert-butylphenyl)-λ4-sulfanyl] 1,2,2,3,3,4,4,5,5,6,6-undecafluorocyclohexane-1-carboxylate.
| Compound Name | [tris(4-tert-butylphenyl)-λ4-sulfanyl] 1,2,2,3,3,4,4,5,5,6,6-undecafluorocyclohexane-1-carboxylate |
|---|---|
| PubChem CID | 87756279 |
| Molecular Formula | C37H39F11O2S |
| Molecular Weight | 756.76 g/mol |
| Exact Mass | 756.25 |
| IUPAC Name | [tris(4-tert-butylphenyl)-λ4-sulfanyl] 1,2,2,3,3,4,4,5,5,6,6-undecafluorocyclohexane-1-carboxylate |
| SMILES | CC(C)(C)c1ccc(S(OC(=O)C2(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)C2(F)F)(c2ccc(C(C)(C)C)cc2)c2ccc(C(C)(C)C)cc2)cc1 |
| InChI | InChI=1S/C37H39F11O2S/c1-29(2,3)22-10-16-25(17-11-22)51(26-18-12-23(13-19-26)30(4,5)6,27-20-14-24(15-21-27)31(7,8)9)50-28(49)32(38)33(39,40)35(43,44)37(47,48)36(45,46)34(32,41)42/h10-21H,1-9H3 |
| InChIKey | XXAITLPFFMIJHR-UHFFFAOYSA-N |
| XLogP | 12.22 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 51 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 756.76 |
| LogP ≤ 5 | 12.22 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|