C44H30F12O4S2 — CID 87756366
2,2,3,3,4,4,5,5,6,6,7,7-dodecafluorooctanedioate;bis(triphenylsulfanium) (PubChem CID 87756366) has the molecular formula C44H30F12O4S2 and a molecular weight of 914.83 g/mol. Its IUPAC name is 2,2,3,3,4,4,5,5,6,6,7,7-dodecafluorooctanedioate;bis(triphenylsulfanium).
| Compound Name | 2,2,3,3,4,4,5,5,6,6,7,7-dodecafluorooctanedioate;bis(triphenylsulfanium) |
|---|---|
| PubChem CID | 87756366 |
| Molecular Formula | C44H30F12O4S2 |
| Molecular Weight | 914.83 g/mol |
| Exact Mass | 914.14 |
| IUPAC Name | 2,2,3,3,4,4,5,5,6,6,7,7-dodecafluorooctanedioate;bis(triphenylsulfanium) |
| SMILES | O=C([O-])C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(=O)[O-].c1ccc([S+](c2ccccc2)c2ccccc2)cc1.c1ccc([S+](c2ccccc2)c2ccccc2)cc1 |
| InChI | InChI=1S/2C18H15S.C8H2F12O4/c2*1-4-10-16(11-5-1)19(17-12-6-2-7-13-17)18-14-8-3-9-15-18;9-3(10,1(21)22)5(13,14)7(17,18)8(19,20)6(15,16)4(11,12)2(23)24/h2*1-15H;(H,21,22)(H,23,24)/q2*+1;/p-2 |
| InChIKey | QBLBMGUVZYKZMH-UHFFFAOYSA-L |
| XLogP | 9.86 |
| TPSA | 80.26 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 62 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 914.83 |
| LogP ≤ 5 | 9.86 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'charged_oxygen_or_sulfur_atoms', 'substructure': 'N/A'}, {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|