C14H15ClF2N2O3S2 — CID 87756492
2-chloro-4,5-difluoro-N-[4-(3-hydroxypentan-3-yl)-1,3-thiazol-2-yl]benzenesulfonamide (PubChem CID 87756492) has the molecular formula C14H15ClF2N2O3S2 and a molecular weight of 396.87 g/mol. Its IUPAC name is 2-chloro-4,5-difluoro-N-[4-(3-hydroxypentan-3-yl)-1,3-thiazol-2-yl]benzenesulfonamide.
| Compound Name | 2-chloro-4,5-difluoro-N-[4-(3-hydroxypentan-3-yl)-1,3-thiazol-2-yl]benzenesulfonamide |
|---|---|
| PubChem CID | 87756492 |
| Molecular Formula | C14H15ClF2N2O3S2 |
| Molecular Weight | 396.87 g/mol |
| Exact Mass | 396.02 |
| IUPAC Name | 2-chloro-4,5-difluoro-N-[4-(3-hydroxypentan-3-yl)-1,3-thiazol-2-yl]benzenesulfonamide |
| SMILES | CCC(O)(CC)c1csc(NS(=O)(=O)c2cc(F)c(F)cc2Cl)n1 |
| InChI | InChI=1S/C14H15ClF2N2O3S2/c1-3-14(20,4-2)12-7-23-13(18-12)19-24(21,22)11-6-10(17)9(16)5-8(11)15/h5-7,20H,3-4H2,1-2H3,(H,18,19) |
| InChIKey | PJHOTYJUJQVFOM-UHFFFAOYSA-N |
| XLogP | 3.88 |
| TPSA | 79.29 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 396.87 |
| LogP ≤ 5 | 3.88 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'} |
|---|