C28H19F15O2S — CID 87756624
bis(4-methylphenyl)-phenylsulfanium;2,2,3,3,4,4,5,5,6,6,7,7,8,8,8-pentadecafluorooctanoate (PubChem CID 87756624) has the molecular formula C28H19F15O2S and a molecular weight of 704.50 g/mol. Its IUPAC name is bis(4-methylphenyl)-phenylsulfanium;2,2,3,3,4,4,5,5,6,6,7,7,8,8,8-pentadecafluorooctanoate.
| Compound Name | bis(4-methylphenyl)-phenylsulfanium;2,2,3,3,4,4,5,5,6,6,7,7,8,8,8-pentadecafluorooctanoate |
|---|---|
| PubChem CID | 87756624 |
| Molecular Formula | C28H19F15O2S |
| Molecular Weight | 704.50 g/mol |
| Exact Mass | 704.09 |
| IUPAC Name | bis(4-methylphenyl)-phenylsulfanium;2,2,3,3,4,4,5,5,6,6,7,7,8,8,8-pentadecafluorooctanoate |
| SMILES | Cc1ccc([S+](c2ccccc2)c2ccc(C)cc2)cc1.O=C([O-])C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)F |
| InChI | InChI=1S/C20H19S.C8HF15O2/c1-16-8-12-19(13-9-16)21(18-6-4-3-5-7-18)20-14-10-17(2)11-15-20;9-2(10,1(24)25)3(11,12)4(13,14)5(15,16)6(17,18)7(19,20)8(21,22)23/h3-15H,1-2H3;(H,24,25)/q+1;/p-1 |
| InChIKey | CYANNFZLFZCZRS-UHFFFAOYSA-M |
| XLogP | 8.51 |
| TPSA | 40.13 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 46 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 704.50 |
| LogP ≤ 5 | 8.51 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'charged_oxygen_or_sulfur_atoms', 'substructure': 'N/A'}, {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|