C9H18N2OS — CID 87756668
(2S,3S)-2-amino-1-(4,5-dihydro-3H-1,3-thiazol-1-yl)-3-methylpentan-1-one (PubChem CID 87756668) has the molecular formula C9H18N2OS and a molecular weight of 202.32 g/mol. Its IUPAC name is (2S,3S)-2-amino-1-(4,5-dihydro-3H-1,3-thiazol-1-yl)-3-methylpentan-1-one.
| Compound Name | (2S,3S)-2-amino-1-(4,5-dihydro-3H-1,3-thiazol-1-yl)-3-methylpentan-1-one |
|---|---|
| PubChem CID | 87756668 |
| Molecular Formula | C9H18N2OS |
| Molecular Weight | 202.32 g/mol |
| Exact Mass | 202.11 |
| IUPAC Name | (2S,3S)-2-amino-1-(4,5-dihydro-3H-1,3-thiazol-1-yl)-3-methylpentan-1-one |
| SMILES | CC[C@H](C)[C@H](N)C(=O)S1=CNCC1 |
| InChI | InChI=1S/C9H18N2OS/c1-3-7(2)8(10)9(12)13-5-4-11-6-13/h6-8,11H,3-5,10H2,1-2H3/t7-,8-,13?/m0/s1 |
| InChIKey | FUNLRWZRVHKJAM-UDUUBDRPSA-N |
| XLogP | 0.52 |
| TPSA | 55.12 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 202.32 |
| LogP ≤ 5 | 0.52 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'}, {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|