C40H30F4O4S2 — CID 87757189
bis(triphenyl-λ4-sulfanyl) 2,2,3,3-tetrafluorobutanedioate (PubChem CID 87757189) has the molecular formula C40H30F4O4S2 and a molecular weight of 714.80 g/mol. Its IUPAC name is bis(triphenyl-λ4-sulfanyl) 2,2,3,3-tetrafluorobutanedioate.
| Compound Name | bis(triphenyl-λ4-sulfanyl) 2,2,3,3-tetrafluorobutanedioate |
|---|---|
| PubChem CID | 87757189 |
| Molecular Formula | C40H30F4O4S2 |
| Molecular Weight | 714.80 g/mol |
| Exact Mass | 714.15 |
| IUPAC Name | bis(triphenyl-λ4-sulfanyl) 2,2,3,3-tetrafluorobutanedioate |
| SMILES | O=C(OS(c1ccccc1)(c1ccccc1)c1ccccc1)C(F)(F)C(F)(F)C(=O)OS(c1ccccc1)(c1ccccc1)c1ccccc1 |
| InChI | InChI=1S/C40H30F4O4S2/c41-39(42,37(45)47-49(31-19-7-1-8-20-31,32-21-9-2-10-22-32)33-23-11-3-12-24-33)40(43,44)38(46)48-50(34-25-13-4-14-26-34,35-27-15-5-16-28-35)36-29-17-6-18-30-36/h1-30H |
| InChIKey | JHLFACZYHVNBFE-UHFFFAOYSA-N |
| XLogP | 11.14 |
| TPSA | 52.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 50 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 714.80 |
| LogP ≤ 5 | 11.14 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|