methyl (methoxycarbonyl-methyl-trimethylsilyloxysilyl)formate

C8H18O5Si2 — CID 87757512

IUPACmethyl (methoxycarbonyl-methyl-trimethylsilyloxysilyl)formate
SMILESCOC(=O)[Si](C)(O[Si](C)(C)C)C(=O)OC
InChIInChI=1S/C8H18O5Si2/c1-11-7(9)15(6,8(10)12-2)13-14(3,4)5/h1-6H3
InChIKeyMRLZLMRKBPBELC-UHFFFAOYSA-N
MW250.40 g/mol
LogP2.11
Rot. Bonds4

About methyl (methoxycarbonyl-methyl-trimethylsilyloxysilyl)formate

methyl (methoxycarbonyl-methyl-trimethylsilyloxysilyl)formate (PubChem CID 87757512) has the molecular formula C8H18O5Si2 and a molecular weight of 250.40 g/mol. Its IUPAC name is methyl (methoxycarbonyl-methyl-trimethylsilyloxysilyl)formate.

Molecular Properties

Compound Namemethyl (methoxycarbonyl-methyl-trimethylsilyloxysilyl)formate
PubChem CID87757512
Molecular FormulaC8H18O5Si2
Molecular Weight250.40 g/mol
Exact Mass250.07
IUPAC Namemethyl (methoxycarbonyl-methyl-trimethylsilyloxysilyl)formate
SMILESCOC(=O)[Si](C)(O[Si](C)(C)C)C(=O)OC
InChIInChI=1S/C8H18O5Si2/c1-11-7(9)15(6,8(10)12-2)13-14(3,4)5/h1-6H3
InChIKeyMRLZLMRKBPBELC-UHFFFAOYSA-N
XLogP2.11
TPSA61.83 Ų
H-Bond Donors
H-Bond Acceptors5
Rotatable Bonds4
Heavy Atoms15
Complexity—

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500250.40
LogP ≤ 52.11
H-Bond Donors ≤ 50
H-Bond Acceptors ≤ 105

Computed Properties (RDKit)

Structural Alerts{'alert_name': 'heavy_metal', 'substructure': 'N/A'}

Analyze methyl (methoxycarbonyl-methyl-trimethylsilyloxysilyl)formate with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of methyl (methoxycarbonyl-methyl-trimethylsilyloxysilyl)formate?
The IUPAC name of methyl (methoxycarbonyl-methyl-trimethylsilyloxysilyl)formate (CID 87757512) is methyl (methoxycarbonyl-methyl-trimethylsilyloxysilyl)formate.
What is the SMILES notation for methyl (methoxycarbonyl-methyl-trimethylsilyloxysilyl)formate?
The canonical SMILES for methyl (methoxycarbonyl-methyl-trimethylsilyloxysilyl)formate is COC(=O)[Si](C)(O[Si](C)(C)C)C(=O)OC.
What is the InChIKey of methyl (methoxycarbonyl-methyl-trimethylsilyloxysilyl)formate?
The InChIKey is MRLZLMRKBPBELC-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H18O5Si2/c1-11-7(9)15(6,8(10)12-2)13-14(3,4)5/h1-6H3.
What are the key properties of methyl (methoxycarbonyl-methyl-trimethylsilyloxysilyl)formate?
methyl (methoxycarbonyl-methyl-trimethylsilyloxysilyl)formate has a molecular weight of 250.40 g/mol, XLogP of 2.11, 4 rotatable bonds, 0 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for methyl (methoxycarbonyl-methyl-trimethylsilyloxysilyl)formate is sourced from PubChem (CID 87757512), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).