C7H5N2O- — CID 87757695
1-oxidopyrrolo[2,3-c]pyridine (PubChem CID 87757695) has the molecular formula C7H5N2O- and a molecular weight of 133.13 g/mol. Its IUPAC name is 1-oxidopyrrolo[2,3-c]pyridine.
| Compound Name | 1-oxidopyrrolo[2,3-c]pyridine |
|---|---|
| PubChem CID | 87757695 |
| Molecular Formula | C7H5N2O- |
| Molecular Weight | 133.13 g/mol |
| Exact Mass | 133.04 |
| IUPAC Name | 1-oxidopyrrolo[2,3-c]pyridine |
| SMILES | [O-]n1ccc2ccncc21 |
| InChI | InChI=1S/C7H5N2O/c10-9-4-2-6-1-3-8-5-7(6)9/h1-5H/q-1 |
| InChIKey | PJTKXWQQISPDON-UHFFFAOYSA-N |
| XLogP | 1.38 |
| TPSA | 40.88 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 10 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 133.13 |
| LogP ≤ 5 | 1.38 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'N_oxide', 'substructure': 'N/A'} |
|---|