About 1-oxidopyrrolo[2,3-c]pyridine
1-oxidopyrrolo[2,3-c]pyridine (PubChem CID 87757695) has the molecular formula C7H5N2O-
and a molecular weight of 133.13 g/mol. Its IUPAC name is 1-oxidopyrrolo[2,3-c]pyridine.
Molecular Properties
| Compound Name | 1-oxidopyrrolo[2,3-c]pyridine |
| PubChem CID | 87757695 |
| Molecular Formula | C7H5N2O- |
| Molecular Weight | 133.13 g/mol |
| Exact Mass | 133.04 |
| IUPAC Name | 1-oxidopyrrolo[2,3-c]pyridine |
| SMILES | [O-]n1ccc2ccncc21 |
| InChI | InChI=1S/C7H5N2O/c10-9-4-2-6-1-3-8-5-7(6)9/h1-5H/q-1 |
| InChIKey | PJTKXWQQISPDON-UHFFFAOYSA-N |
| XLogP | 1.38 |
| TPSA | 40.88 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 10 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 133.13 |
| LogP ≤ 5 | 1.38 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'N_oxide', 'substructure': 'N/A'} |
|---|
Analyze 1-oxidopyrrolo[2,3-c]pyridine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-oxidopyrrolo[2,3-c]pyridine?
The IUPAC name of 1-oxidopyrrolo[2,3-c]pyridine (CID 87757695) is 1-oxidopyrrolo[2,3-c]pyridine.
What is the SMILES notation for 1-oxidopyrrolo[2,3-c]pyridine?
The canonical SMILES for 1-oxidopyrrolo[2,3-c]pyridine is [O-]n1ccc2ccncc21.
What is the InChIKey of 1-oxidopyrrolo[2,3-c]pyridine?
The InChIKey is PJTKXWQQISPDON-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H5N2O/c10-9-4-2-6-1-3-8-5-7(6)9/h1-5H/q-1.
What are the key properties of 1-oxidopyrrolo[2,3-c]pyridine?
1-oxidopyrrolo[2,3-c]pyridine has a molecular weight of 133.13 g/mol, XLogP of 1.38, 0 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 1-oxidopyrrolo[2,3-c]pyridine is sourced from PubChem (CID 87757695), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).