C23H29NO4 — CID 87757872
(2E,4E)-3-methyl-6-oxo-6-(6,6,9,9-tetramethyl-2,3,7,8-tetrahydrobenzo[g][1,4]benzoxazin-4-yl)hexa-2,4-dienoic acid (PubChem CID 87757872) has the molecular formula C23H29NO4 and a molecular weight of 383.49 g/mol. Its IUPAC name is (2E,4E)-3-methyl-6-oxo-6-(6,6,9,9-tetramethyl-2,3,7,8-tetrahydrobenzo[g][1,4]benzoxazin-4-yl)hexa-2,4-dienoic acid.
| Compound Name | (2E,4E)-3-methyl-6-oxo-6-(6,6,9,9-tetramethyl-2,3,7,8-tetrahydrobenzo[g][1,4]benzoxazin-4-yl)hexa-2,4-dienoic acid |
|---|---|
| PubChem CID | 87757872 |
| Molecular Formula | C23H29NO4 |
| Molecular Weight | 383.49 g/mol |
| Exact Mass | 383.21 |
| IUPAC Name | (2E,4E)-3-methyl-6-oxo-6-(6,6,9,9-tetramethyl-2,3,7,8-tetrahydrobenzo[g][1,4]benzoxazin-4-yl)hexa-2,4-dienoic acid |
| SMILES | CC(/C=C/C(=O)N1CCOc2cc3c(cc21)C(C)(C)CCC3(C)C)=C\C(=O)O |
| InChI | InChI=1S/C23H29NO4/c1-15(12-21(26)27)6-7-20(25)24-10-11-28-19-14-17-16(13-18(19)24)22(2,3)8-9-23(17,4)5/h6-7,12-14H,8-11H2,1-5H3,(H,26,27)/b7-6+,15-12+ |
| InChIKey | YPWMDWHYOXPQKK-SIKOUFMJSA-N |
| XLogP | 4.35 |
| TPSA | 66.84 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 383.49 |
| LogP ≤ 5 | 4.35 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|