About tert-butyl-[(E,3R)-4,4-difluoro-1-iodooct-1-en-3-yl]oxy-dimethylsilane
tert-butyl-[(E,3R)-4,4-difluoro-1-iodooct-1-en-3-yl]oxy-dimethylsilane (PubChem CID 87758246) has the molecular formula C14H27F2IOSi
and a molecular weight of 404.36 g/mol. Its IUPAC name is tert-butyl-[(E,3R)-4,4-difluoro-1-iodooct-1-en-3-yl]oxy-dimethylsilane.
Molecular Properties
| Compound Name | tert-butyl-[(E,3R)-4,4-difluoro-1-iodooct-1-en-3-yl]oxy-dimethylsilane |
| PubChem CID | 87758246 |
| Molecular Formula | C14H27F2IOSi |
| Molecular Weight | 404.36 g/mol |
| Exact Mass | 404.08 |
| IUPAC Name | tert-butyl-[(E,3R)-4,4-difluoro-1-iodooct-1-en-3-yl]oxy-dimethylsilane |
| SMILES | CCCCC(F)(F)[C@@H](/C=C/I)O[Si](C)(C)C(C)(C)C |
| InChI | InChI=1S/C14H27F2IOSi/c1-7-8-10-14(15,16)12(9-11-17)18-19(5,6)13(2,3)4/h9,11-12H,7-8,10H2,1-6H3/b11-9+/t12-/m1/s1 |
| InChIKey | FICFZELBMPGGQU-LMMOQWNQSA-N |
| XLogP | 6.15 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 404.36 |
| LogP ≤ 5 | 6.15 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|
Analyze tert-butyl-[(E,3R)-4,4-difluoro-1-iodooct-1-en-3-yl]oxy-dimethylsilane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of tert-butyl-[(E,3R)-4,4-difluoro-1-iodooct-1-en-3-yl]oxy-dimethylsilane?
The IUPAC name of tert-butyl-[(E,3R)-4,4-difluoro-1-iodooct-1-en-3-yl]oxy-dimethylsilane (CID 87758246) is tert-butyl-[(E,3R)-4,4-difluoro-1-iodooct-1-en-3-yl]oxy-dimethylsilane.
What is the SMILES notation for tert-butyl-[(E,3R)-4,4-difluoro-1-iodooct-1-en-3-yl]oxy-dimethylsilane?
The canonical SMILES for tert-butyl-[(E,3R)-4,4-difluoro-1-iodooct-1-en-3-yl]oxy-dimethylsilane is CCCCC(F)(F)[C@@H](/C=C/I)O[Si](C)(C)C(C)(C)C.
What is the InChIKey of tert-butyl-[(E,3R)-4,4-difluoro-1-iodooct-1-en-3-yl]oxy-dimethylsilane?
The InChIKey is FICFZELBMPGGQU-LMMOQWNQSA-N. The full InChI is InChI=1S/C14H27F2IOSi/c1-7-8-10-14(15,16)12(9-11-17)18-19(5,6)13(2,3)4/h9,11-12H,7-8,10H2,1-6H3/b11-9+/t12-/m1/s1.
What are the key properties of tert-butyl-[(E,3R)-4,4-difluoro-1-iodooct-1-en-3-yl]oxy-dimethylsilane?
tert-butyl-[(E,3R)-4,4-difluoro-1-iodooct-1-en-3-yl]oxy-dimethylsilane has a molecular weight of 404.36 g/mol, XLogP of 6.15, 7 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for tert-butyl-[(E,3R)-4,4-difluoro-1-iodooct-1-en-3-yl]oxy-dimethylsilane is sourced from PubChem (CID 87758246), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).