C35H44N2O4S — CID 87758464
(2R,3S)-3-(dibenzylamino)-1-(2-methylpropylamino)-4-phenylbutan-2-ol;2-methylbenzenesulfonic acid (PubChem CID 87758464) has the molecular formula C35H44N2O4S and a molecular weight of 588.81 g/mol. Its IUPAC name is (2R,3S)-3-(dibenzylamino)-1-(2-methylpropylamino)-4-phenylbutan-2-ol;2-methylbenzenesulfonic acid.
| Compound Name | (2R,3S)-3-(dibenzylamino)-1-(2-methylpropylamino)-4-phenylbutan-2-ol;2-methylbenzenesulfonic acid |
|---|---|
| PubChem CID | 87758464 |
| Molecular Formula | C35H44N2O4S |
| Molecular Weight | 588.81 g/mol |
| Exact Mass | 588.30 |
| IUPAC Name | (2R,3S)-3-(dibenzylamino)-1-(2-methylpropylamino)-4-phenylbutan-2-ol;2-methylbenzenesulfonic acid |
| SMILES | CC(C)CNC[C@@H](O)[C@H](Cc1ccccc1)N(Cc1ccccc1)Cc1ccccc1.Cc1ccccc1S(=O)(=O)O |
| InChI | InChI=1S/C28H36N2O.C7H8O3S/c1-23(2)19-29-20-28(31)27(18-24-12-6-3-7-13-24)30(21-25-14-8-4-9-15-25)22-26-16-10-5-11-17-26;1-6-4-2-3-5-7(6)11(8,9)10/h3-17,23,27-29,31H,18-22H2,1-2H3;2-5H,1H3,(H,8,9,10)/t27-,28+;/m0./s1 |
| InChIKey | SVRLWSOWWALJJS-DUZWKJOOSA-N |
| XLogP | 6.15 |
| TPSA | 89.87 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 588.81 |
| LogP ≤ 5 | 6.15 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|