C17H10O — CID 87758879
tetracyclo[8.6.1.02,7.014,17]heptadeca-1(17),2,4,6,8,10,12,14-octaen-16-one (PubChem CID 87758879) has the molecular formula C17H10O and a molecular weight of 230.27 g/mol. Its IUPAC name is tetracyclo[8.6.1.02,7.014,17]heptadeca-1(17),2,4,6,8,10,12,14-octaen-16-one.
| Compound Name | tetracyclo[8.6.1.02,7.014,17]heptadeca-1(17),2,4,6,8,10,12,14-octaen-16-one |
|---|---|
| PubChem CID | 87758879 |
| Molecular Formula | C17H10O |
| Molecular Weight | 230.27 g/mol |
| Exact Mass | 230.07 |
| IUPAC Name | tetracyclo[8.6.1.02,7.014,17]heptadeca-1(17),2,4,6,8,10,12,14-octaen-16-one |
| SMILES | O=C1C=c2cccc3c2=C1c1ccccc1C=C3 |
| InChI | InChI=1S/C17H10O/c18-15-10-13-6-3-5-12-9-8-11-4-1-2-7-14(11)17(15)16(12)13/h1-10H |
| InChIKey | CRCLTQGJYBQUKO-UHFFFAOYSA-N |
| XLogP | 1.73 |
| TPSA | 17.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 230.27 |
| LogP ≤ 5 | 1.73 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'stilbene', 'substructure': 'N/A'} |
|---|