C28H26F6N6O2 — CID 87758923
N-[4-[1,1,1,3,3,3-hexafluoro-2-[[(2S)-pyrrolidin-2-yl]methoxy]propan-2-yl]phenyl]-2-[methyl(1H-pyrrolo[2,3-b]pyridin-4-yl)amino]pyridine-3-carboxamide (PubChem CID 87758923) has the molecular formula C28H26F6N6O2 and a molecular weight of 592.54 g/mol. Its IUPAC name is N-[4-[1,1,1,3,3,3-hexafluoro-2-[[(2S)-pyrrolidin-2-yl]methoxy]propan-2-yl]phenyl]-2-[methyl(1H-pyrrolo[2,3-b]pyridin-4-yl)amino]pyridine-3-carboxamide.
| Compound Name | N-[4-[1,1,1,3,3,3-hexafluoro-2-[[(2S)-pyrrolidin-2-yl]methoxy]propan-2-yl]phenyl]-2-[methyl(1H-pyrrolo[2,3-b]pyridin-4-yl)amino]pyridine-3-carboxamide |
|---|---|
| PubChem CID | 87758923 |
| Molecular Formula | C28H26F6N6O2 |
| Molecular Weight | 592.54 g/mol |
| Exact Mass | 592.20 |
| IUPAC Name | N-[4-[1,1,1,3,3,3-hexafluoro-2-[[(2S)-pyrrolidin-2-yl]methoxy]propan-2-yl]phenyl]-2-[methyl(1H-pyrrolo[2,3-b]pyridin-4-yl)amino]pyridine-3-carboxamide |
| SMILES | CN(c1ncccc1C(=O)Nc1ccc(C(OC[C@@H]2CCCN2)(C(F)(F)F)C(F)(F)F)cc1)c1ccnc2[nH]ccc12 |
| InChI | InChI=1S/C28H26F6N6O2/c1-40(22-11-15-37-23-20(22)10-14-36-23)24-21(5-3-13-38-24)25(41)39-18-8-6-17(7-9-18)26(27(29,30)31,28(32,33)34)42-16-19-4-2-12-35-19/h3,5-11,13-15,19,35H,2,4,12,16H2,1H3,(H,36,37)(H,39,41)/t19-/m0/s1 |
| InChIKey | ZTOXADGAJSRGSB-IBGZPJMESA-N |
| XLogP | 6.07 |
| TPSA | 95.17 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 592.54 |
| LogP ≤ 5 | 6.07 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |