C26H39N3O3S — CID 87759524
[[N,N'-bis(4-hexylphenyl)carbamimidoyl]amino] methanesulfonate (PubChem CID 87759524) has the molecular formula C26H39N3O3S and a molecular weight of 473.68 g/mol. Its IUPAC name is [[N,N'-bis(4-hexylphenyl)carbamimidoyl]amino] methanesulfonate.
| Compound Name | [[N,N'-bis(4-hexylphenyl)carbamimidoyl]amino] methanesulfonate |
|---|---|
| PubChem CID | 87759524 |
| Molecular Formula | C26H39N3O3S |
| Molecular Weight | 473.68 g/mol |
| Exact Mass | 473.27 |
| IUPAC Name | [[N,N'-bis(4-hexylphenyl)carbamimidoyl]amino] methanesulfonate |
| SMILES | CCCCCCc1ccc(/N=C(\NOS(C)(=O)=O)Nc2ccc(CCCCCC)cc2)cc1 |
| InChI | InChI=1S/C26H39N3O3S/c1-4-6-8-10-12-22-14-18-24(19-15-22)27-26(29-32-33(3,30)31)28-25-20-16-23(17-21-25)13-11-9-7-5-2/h14-21H,4-13H2,1-3H3,(H2,27,28,29) |
| InChIKey | LIUNIFNHLGCJPG-UHFFFAOYSA-N |
| XLogP | 6.51 |
| TPSA | 79.79 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 473.68 |
| LogP ≤ 5 | 6.51 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|