C14H17Cl4NO2 — CID 87760242
2-(aminomethyl)-4-methyl-5-(2,3,4,6-tetrachlorophenyl)hexanoic acid (PubChem CID 87760242) has the molecular formula C14H17Cl4NO2 and a molecular weight of 373.11 g/mol. Its IUPAC name is 2-(aminomethyl)-4-methyl-5-(2,3,4,6-tetrachlorophenyl)hexanoic acid.
| Compound Name | 2-(aminomethyl)-4-methyl-5-(2,3,4,6-tetrachlorophenyl)hexanoic acid |
|---|---|
| PubChem CID | 87760242 |
| Molecular Formula | C14H17Cl4NO2 |
| Molecular Weight | 373.11 g/mol |
| Exact Mass | 371.00 |
| IUPAC Name | 2-(aminomethyl)-4-methyl-5-(2,3,4,6-tetrachlorophenyl)hexanoic acid |
| SMILES | CC(CC(CN)C(=O)O)C(C)c1c(Cl)cc(Cl)c(Cl)c1Cl |
| InChI | InChI=1S/C14H17Cl4NO2/c1-6(3-8(5-19)14(20)21)7(2)11-9(15)4-10(16)12(17)13(11)18/h4,6-8H,3,5,19H2,1-2H3,(H,20,21) |
| InChIKey | YKLZOWQRXRCHAH-UHFFFAOYSA-N |
| XLogP | 5.09 |
| TPSA | 63.32 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 21 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 373.11 |
| LogP ≤ 5 | 5.09 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'} |
|---|