C31H26N8O — CID 87760393
1,3-bis[3-(3,5-dicyano-2,6-dimethyl-1,4-dihydropyridin-4-yl)phenyl]urea (PubChem CID 87760393) has the molecular formula C31H26N8O and a molecular weight of 526.60 g/mol. Its IUPAC name is 1,3-bis[3-(3,5-dicyano-2,6-dimethyl-1,4-dihydropyridin-4-yl)phenyl]urea.
| Compound Name | 1,3-bis[3-(3,5-dicyano-2,6-dimethyl-1,4-dihydropyridin-4-yl)phenyl]urea |
|---|---|
| PubChem CID | 87760393 |
| Molecular Formula | C31H26N8O |
| Molecular Weight | 526.60 g/mol |
| Exact Mass | 526.22 |
| IUPAC Name | 1,3-bis[3-(3,5-dicyano-2,6-dimethyl-1,4-dihydropyridin-4-yl)phenyl]urea |
| SMILES | CC1=C(C#N)C(c2cccc(NC(=O)Nc3cccc(C4C(C#N)=C(C)NC(C)=C4C#N)c3)c2)C(C#N)=C(C)N1 |
| InChI | InChI=1S/C31H26N8O/c1-17-25(13-32)29(26(14-33)18(2)36-17)21-7-5-9-23(11-21)38-31(40)39-24-10-6-8-22(12-24)30-27(15-34)19(3)37-20(4)28(30)16-35/h5-12,29-30,36-37H,1-4H3,(H2,38,39,40) |
| InChIKey | UVIPSIWDZUVKQU-UHFFFAOYSA-N |
| XLogP | 5.89 |
| TPSA | 160.35 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 526.60 |
| LogP ≤ 5 | 5.89 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 7 |