C23H26F4O3S2 — CID 87760910
(1-naphthalen-2-ylthiolan-1-yl) 2-(2-bicyclo[2.2.1]heptanyl)-1,1,2,2-tetrafluoroethanesulfonate (PubChem CID 87760910) has the molecular formula C23H26F4O3S2 and a molecular weight of 490.58 g/mol. Its IUPAC name is (1-naphthalen-2-ylthiolan-1-yl) 2-(2-bicyclo[2.2.1]heptanyl)-1,1,2,2-tetrafluoroethanesulfonate.
| Compound Name | (1-naphthalen-2-ylthiolan-1-yl) 2-(2-bicyclo[2.2.1]heptanyl)-1,1,2,2-tetrafluoroethanesulfonate |
|---|---|
| PubChem CID | 87760910 |
| Molecular Formula | C23H26F4O3S2 |
| Molecular Weight | 490.58 g/mol |
| Exact Mass | 490.13 |
| IUPAC Name | (1-naphthalen-2-ylthiolan-1-yl) 2-(2-bicyclo[2.2.1]heptanyl)-1,1,2,2-tetrafluoroethanesulfonate |
| SMILES | O=S(=O)(OS1(c2ccc3ccccc3c2)CCCC1)C(F)(F)C(F)(F)C1CC2CCC1C2 |
| InChI | InChI=1S/C23H26F4O3S2/c24-22(25,21-14-16-7-8-19(21)13-16)23(26,27)32(28,29)30-31(11-3-4-12-31)20-10-9-17-5-1-2-6-18(17)15-20/h1-2,5-6,9-10,15-16,19,21H,3-4,7-8,11-14H2 |
| InChIKey | XRAJMFLVZBZCKG-UHFFFAOYSA-N |
| XLogP | 6.72 |
| TPSA | 43.37 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 490.58 |
| LogP ≤ 5 | 6.72 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|