C31H30BF3O9S — CID 87761440
methyl 6-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)naphthalene-1-carboxylate;methyl 6-(trifluoromethylsulfonyloxy)naphthalene-1-carboxylate (PubChem CID 87761440) has the molecular formula C31H30BF3O9S and a molecular weight of 646.45 g/mol. Its IUPAC name is methyl 6-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)naphthalene-1-carboxylate;methyl 6-(trifluoromethylsulfonyloxy)naphthalene-1-carboxylate.
| Compound Name | methyl 6-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)naphthalene-1-carboxylate;methyl 6-(trifluoromethylsulfonyloxy)naphthalene-1-carboxylate |
|---|---|
| PubChem CID | 87761440 |
| Molecular Formula | C31H30BF3O9S |
| Molecular Weight | 646.45 g/mol |
| Exact Mass | 646.17 |
| IUPAC Name | methyl 6-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)naphthalene-1-carboxylate;methyl 6-(trifluoromethylsulfonyloxy)naphthalene-1-carboxylate |
| SMILES | COC(=O)c1cccc2cc(B3OC(C)(C)C(C)(C)O3)ccc12.COC(=O)c1cccc2cc(OS(=O)(=O)C(F)(F)F)ccc12 |
| InChI | InChI=1S/C18H21BO4.C13H9F3O5S/c1-17(2)18(3,4)23-19(22-17)13-9-10-14-12(11-13)7-6-8-15(14)16(20)21-5;1-20-12(17)11-4-2-3-8-7-9(5-6-10(8)11)21-22(18,19)13(14,15)16/h6-11H,1-5H3;2-7H,1H3 |
| InChIKey | ZURJGJFWNZWHQQ-UHFFFAOYSA-N |
| XLogP | 5.78 |
| TPSA | 114.43 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 45 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 646.45 |
| LogP ≤ 5 | 5.78 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'}, {'alert_name': 'triflate', 'substructure': 'N/A'} |
|---|