About 3,4-dihydroisoquinoline;sulfane
3,4-dihydroisoquinoline;sulfane (PubChem CID 87761448) has the molecular formula C9H11NS
and a molecular weight of 165.26 g/mol. Its IUPAC name is 3,4-dihydroisoquinoline;sulfane.
Molecular Properties
| Compound Name | 3,4-dihydroisoquinoline;sulfane |
| PubChem CID | 87761448 |
| Molecular Formula | C9H11NS |
| Molecular Weight | 165.26 g/mol |
| Exact Mass | 165.06 |
| IUPAC Name | 3,4-dihydroisoquinoline;sulfane |
| SMILES | C1=NCCc2ccccc21.S |
| InChI | InChI=1S/C9H9N.H2S/c1-2-4-9-7-10-6-5-8(9)3-1;/h1-4,7H,5-6H2;1H2 |
| InChIKey | ATSINEAUUWZFGB-UHFFFAOYSA-N |
| XLogP | 1.77 |
| TPSA | 12.36 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 11 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 165.26 |
| LogP ≤ 5 | 1.77 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Analyze 3,4-dihydroisoquinoline;sulfane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3,4-dihydroisoquinoline;sulfane?
The IUPAC name of 3,4-dihydroisoquinoline;sulfane (CID 87761448) is 3,4-dihydroisoquinoline;sulfane.
What is the SMILES notation for 3,4-dihydroisoquinoline;sulfane?
The canonical SMILES for 3,4-dihydroisoquinoline;sulfane is C1=NCCc2ccccc21.S.
What is the InChIKey of 3,4-dihydroisoquinoline;sulfane?
The InChIKey is ATSINEAUUWZFGB-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H9N.H2S/c1-2-4-9-7-10-6-5-8(9)3-1;/h1-4,7H,5-6H2;1H2.
What are the key properties of 3,4-dihydroisoquinoline;sulfane?
3,4-dihydroisoquinoline;sulfane has a molecular weight of 165.26 g/mol, XLogP of 1.77, 0 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 3,4-dihydroisoquinoline;sulfane is sourced from PubChem (CID 87761448), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).