C21H25N3O4S — CID 87761601
4-(4-methoxyphenyl)-3-(2,3,4-trimethoxy-5-propan-2-ylphenyl)-1H-1,2,4-triazole-5-thione (PubChem CID 87761601) has the molecular formula C21H25N3O4S and a molecular weight of 415.52 g/mol. Its IUPAC name is 4-(4-methoxyphenyl)-3-(2,3,4-trimethoxy-5-propan-2-ylphenyl)-1H-1,2,4-triazole-5-thione.
| Compound Name | 4-(4-methoxyphenyl)-3-(2,3,4-trimethoxy-5-propan-2-ylphenyl)-1H-1,2,4-triazole-5-thione |
|---|---|
| PubChem CID | 87761601 |
| Molecular Formula | C21H25N3O4S |
| Molecular Weight | 415.52 g/mol |
| Exact Mass | 415.16 |
| IUPAC Name | 4-(4-methoxyphenyl)-3-(2,3,4-trimethoxy-5-propan-2-ylphenyl)-1H-1,2,4-triazole-5-thione |
| SMILES | COc1ccc(-n2c(-c3cc(C(C)C)c(OC)c(OC)c3OC)n[nH]c2=S)cc1 |
| InChI | InChI=1S/C21H25N3O4S/c1-12(2)15-11-16(18(27-5)19(28-6)17(15)26-4)20-22-23-21(29)24(20)13-7-9-14(25-3)10-8-13/h7-12H,1-6H3,(H,23,29) |
| InChIKey | KXMXBELYTCPMRL-UHFFFAOYSA-N |
| XLogP | 4.75 |
| TPSA | 70.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 415.52 |
| LogP ≤ 5 | 4.75 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|