C26H27F9O5S3 — CID 87761968
[1-[6-(2-bicyclo[2.2.2]octanylsulfonyl)naphthalen-2-yl]thiolan-1-yl] 1,1,2,2,3,3,4,4,4-nonafluorobutane-1-sulfonate (PubChem CID 87761968) has the molecular formula C26H27F9O5S3 and a molecular weight of 686.68 g/mol. Its IUPAC name is [1-[6-(2-bicyclo[2.2.2]octanylsulfonyl)naphthalen-2-yl]thiolan-1-yl] 1,1,2,2,3,3,4,4,4-nonafluorobutane-1-sulfonate.
| Compound Name | [1-[6-(2-bicyclo[2.2.2]octanylsulfonyl)naphthalen-2-yl]thiolan-1-yl] 1,1,2,2,3,3,4,4,4-nonafluorobutane-1-sulfonate |
|---|---|
| PubChem CID | 87761968 |
| Molecular Formula | C26H27F9O5S3 |
| Molecular Weight | 686.68 g/mol |
| Exact Mass | 686.09 |
| IUPAC Name | [1-[6-(2-bicyclo[2.2.2]octanylsulfonyl)naphthalen-2-yl]thiolan-1-yl] 1,1,2,2,3,3,4,4,4-nonafluorobutane-1-sulfonate |
| SMILES | O=S(=O)(c1ccc2cc(S3(OS(=O)(=O)C(F)(F)C(F)(F)C(F)(F)C(F)(F)F)CCCC3)ccc2c1)C1CC2CCC1CC2 |
| InChI | InChI=1S/C26H27F9O5S3/c27-23(28,25(31,32)33)24(29,30)26(34,35)43(38,39)40-41(11-1-2-12-41)20-9-7-19-15-21(10-8-18(19)14-20)42(36,37)22-13-16-3-5-17(22)6-4-16/h7-10,14-17,22H,1-6,11-13H2 |
| InChIKey | IJPLQFABXSLRGR-UHFFFAOYSA-N |
| XLogP | 7.84 |
| TPSA | 77.51 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 43 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 686.68 |
| LogP ≤ 5 | 7.84 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|