C27H29F9O4S2 — CID 87761969
1-[6-(2-bicyclo[2.2.2]octanylmethoxy)naphthalen-2-yl]thiolan-1-ium;1,1,2,2,3,3,4,4,4-nonafluorobutane-1-sulfonate (PubChem CID 87761969) has the molecular formula C27H29F9O4S2 and a molecular weight of 652.64 g/mol. Its IUPAC name is 1-[6-(2-bicyclo[2.2.2]octanylmethoxy)naphthalen-2-yl]thiolan-1-ium;1,1,2,2,3,3,4,4,4-nonafluorobutane-1-sulfonate.
| Compound Name | 1-[6-(2-bicyclo[2.2.2]octanylmethoxy)naphthalen-2-yl]thiolan-1-ium;1,1,2,2,3,3,4,4,4-nonafluorobutane-1-sulfonate |
|---|---|
| PubChem CID | 87761969 |
| Molecular Formula | C27H29F9O4S2 |
| Molecular Weight | 652.64 g/mol |
| Exact Mass | 652.14 |
| IUPAC Name | 1-[6-(2-bicyclo[2.2.2]octanylmethoxy)naphthalen-2-yl]thiolan-1-ium;1,1,2,2,3,3,4,4,4-nonafluorobutane-1-sulfonate |
| SMILES | O=S(=O)([O-])C(F)(F)C(F)(F)C(F)(F)C(F)(F)F.c1cc2cc([S+]3CCCC3)ccc2cc1OCC1CC2CCC1CC2 |
| InChI | InChI=1S/C23H29OS.C4HF9O3S/c1-2-12-25(11-1)23-10-8-19-14-22(9-7-20(19)15-23)24-16-21-13-17-3-5-18(21)6-4-17;5-1(6,3(9,10)11)2(7,8)4(12,13)17(14,15)16/h7-10,14-15,17-18,21H,1-6,11-13,16H2;(H,14,15,16)/q+1;/p-1 |
| InChIKey | OBSJXIPUDROOLG-UHFFFAOYSA-M |
| XLogP | 7.77 |
| TPSA | 66.43 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 652.64 |
| LogP ≤ 5 | 7.77 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'charged_oxygen_or_sulfur_atoms', 'substructure': 'N/A'}, {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|