C27H29F9O4S2 — CID 87761974
[1-[6-(2-bicyclo[2.2.2]octanylmethoxy)naphthalen-2-yl]thiolan-1-yl] 1,1,2,2,3,3,4,4,4-nonafluorobutane-1-sulfonate (PubChem CID 87761974) has the molecular formula C27H29F9O4S2 and a molecular weight of 652.64 g/mol. Its IUPAC name is [1-[6-(2-bicyclo[2.2.2]octanylmethoxy)naphthalen-2-yl]thiolan-1-yl] 1,1,2,2,3,3,4,4,4-nonafluorobutane-1-sulfonate.
| Compound Name | [1-[6-(2-bicyclo[2.2.2]octanylmethoxy)naphthalen-2-yl]thiolan-1-yl] 1,1,2,2,3,3,4,4,4-nonafluorobutane-1-sulfonate |
|---|---|
| PubChem CID | 87761974 |
| Molecular Formula | C27H29F9O4S2 |
| Molecular Weight | 652.64 g/mol |
| Exact Mass | 652.14 |
| IUPAC Name | [1-[6-(2-bicyclo[2.2.2]octanylmethoxy)naphthalen-2-yl]thiolan-1-yl] 1,1,2,2,3,3,4,4,4-nonafluorobutane-1-sulfonate |
| SMILES | O=S(=O)(OS1(c2ccc3cc(OCC4CC5CCC4CC5)ccc3c2)CCCC1)C(F)(F)C(F)(F)C(F)(F)C(F)(F)F |
| InChI | InChI=1S/C27H29F9O4S2/c28-24(29,26(32,33)34)25(30,31)27(35,36)42(37,38)40-41(11-1-2-12-41)23-10-8-19-14-22(9-7-20(19)15-23)39-16-21-13-17-3-5-18(21)6-4-17/h7-10,14-15,17-18,21H,1-6,11-13,16H2 |
| InChIKey | BQGPUJNLNXCVAG-UHFFFAOYSA-N |
| XLogP | 8.69 |
| TPSA | 52.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 652.64 |
| LogP ≤ 5 | 8.69 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|