About (1R)-1-(prop-2-ynylamino)-2,3-dihydro-1H-inden-5-ol
(1R)-1-(prop-2-ynylamino)-2,3-dihydro-1H-inden-5-ol (PubChem CID 87762274) has the molecular formula C12H13NO
and a molecular weight of 187.24 g/mol. Its IUPAC name is (1R)-1-(prop-2-ynylamino)-2,3-dihydro-1H-inden-5-ol.
Molecular Properties
| Compound Name | (1R)-1-(prop-2-ynylamino)-2,3-dihydro-1H-inden-5-ol |
| PubChem CID | 87762274 |
| Molecular Formula | C12H13NO |
| Molecular Weight | 187.24 g/mol |
| Exact Mass | 187.10 |
| IUPAC Name | (1R)-1-(prop-2-ynylamino)-2,3-dihydro-1H-inden-5-ol |
| SMILES | C#CCN[C@@H]1CCc2cc(O)ccc21 |
| InChI | InChI=1S/C12H13NO/c1-2-7-13-12-6-3-9-8-10(14)4-5-11(9)12/h1,4-5,8,12-14H,3,6-7H2/t12-/m1/s1 |
| InChIKey | FWAHICZDXXAZSW-GFCCVEGCSA-N |
| XLogP | 1.60 |
| TPSA | 32.26 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 187.24 |
| LogP ≤ 5 | 1.60 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|
Analyze (1R)-1-(prop-2-ynylamino)-2,3-dihydro-1H-inden-5-ol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (1R)-1-(prop-2-ynylamino)-2,3-dihydro-1H-inden-5-ol?
The IUPAC name of (1R)-1-(prop-2-ynylamino)-2,3-dihydro-1H-inden-5-ol (CID 87762274) is (1R)-1-(prop-2-ynylamino)-2,3-dihydro-1H-inden-5-ol.
What is the SMILES notation for (1R)-1-(prop-2-ynylamino)-2,3-dihydro-1H-inden-5-ol?
The canonical SMILES for (1R)-1-(prop-2-ynylamino)-2,3-dihydro-1H-inden-5-ol is C#CCN[C@@H]1CCc2cc(O)ccc21.
What is the InChIKey of (1R)-1-(prop-2-ynylamino)-2,3-dihydro-1H-inden-5-ol?
The InChIKey is FWAHICZDXXAZSW-GFCCVEGCSA-N. The full InChI is InChI=1S/C12H13NO/c1-2-7-13-12-6-3-9-8-10(14)4-5-11(9)12/h1,4-5,8,12-14H,3,6-7H2/t12-/m1/s1.
What are the key properties of (1R)-1-(prop-2-ynylamino)-2,3-dihydro-1H-inden-5-ol?
(1R)-1-(prop-2-ynylamino)-2,3-dihydro-1H-inden-5-ol has a molecular weight of 187.24 g/mol, XLogP of 1.60, 2 rotatable bonds, 2 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for (1R)-1-(prop-2-ynylamino)-2,3-dihydro-1H-inden-5-ol is sourced from PubChem (CID 87762274), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).