About 2-[(3-benzylcyclopenta-1,3-dien-1-yl)methyl]pyridine;chromium(3+);dichloride
2-[(3-benzylcyclopenta-1,3-dien-1-yl)methyl]pyridine;chromium(3+);dichloride (PubChem CID 87762354) has the molecular formula C18H16Cl2CrN
and a molecular weight of 369.24 g/mol. Its IUPAC name is 2-[(3-benzylcyclopenta-1,3-dien-1-yl)methyl]pyridine;chromium(3+);dichloride.
Molecular Properties
| Compound Name | 2-[(3-benzylcyclopenta-1,3-dien-1-yl)methyl]pyridine;chromium(3+);dichloride |
| PubChem CID | 87762354 |
| Molecular Formula | C18H16Cl2CrN |
| Molecular Weight | 369.24 g/mol |
| Exact Mass | 368.01 |
| IUPAC Name | 2-[(3-benzylcyclopenta-1,3-dien-1-yl)methyl]pyridine;chromium(3+);dichloride |
| SMILES | [C-]1=C(Cc2ccccn2)CC=C1Cc1ccccc1.[Cl-].[Cl-].[Cr+3] |
| InChI | InChI=1S/C18H16N.2ClH.Cr/c1-2-6-15(7-3-1)12-16-9-10-17(13-16)14-18-8-4-5-11-19-18;;;/h1-9,11H,10,12,14H2;2*1H;/q-1;;;+3/p-2 |
| InChIKey | DJVVXVGTELYUFT-UHFFFAOYSA-L |
| XLogP | -2.07 |
| TPSA | 12.89 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 369.24 |
| LogP ≤ 5 | -2.07 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'} |
|---|
Analyze 2-[(3-benzylcyclopenta-1,3-dien-1-yl)methyl]pyridine;chromium(3+);dichloride with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-[(3-benzylcyclopenta-1,3-dien-1-yl)methyl]pyridine;chromium(3+);dichloride?
The IUPAC name of 2-[(3-benzylcyclopenta-1,3-dien-1-yl)methyl]pyridine;chromium(3+);dichloride (CID 87762354) is 2-[(3-benzylcyclopenta-1,3-dien-1-yl)methyl]pyridine;chromium(3+);dichloride.
What is the SMILES notation for 2-[(3-benzylcyclopenta-1,3-dien-1-yl)methyl]pyridine;chromium(3+);dichloride?
The canonical SMILES for 2-[(3-benzylcyclopenta-1,3-dien-1-yl)methyl]pyridine;chromium(3+);dichloride is [C-]1=C(Cc2ccccn2)CC=C1Cc1ccccc1.[Cl-].[Cl-].[Cr+3].
What is the InChIKey of 2-[(3-benzylcyclopenta-1,3-dien-1-yl)methyl]pyridine;chromium(3+);dichloride?
The InChIKey is DJVVXVGTELYUFT-UHFFFAOYSA-L. The full InChI is InChI=1S/C18H16N.2ClH.Cr/c1-2-6-15(7-3-1)12-16-9-10-17(13-16)14-18-8-4-5-11-19-18;;;/h1-9,11H,10,12,14H2;2*1H;/q-1;;;+3/p-2.
What are the key properties of 2-[(3-benzylcyclopenta-1,3-dien-1-yl)methyl]pyridine;chromium(3+);dichloride?
2-[(3-benzylcyclopenta-1,3-dien-1-yl)methyl]pyridine;chromium(3+);dichloride has a molecular weight of 369.24 g/mol, XLogP of -2.07, 4 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 2-[(3-benzylcyclopenta-1,3-dien-1-yl)methyl]pyridine;chromium(3+);dichloride is sourced from PubChem (CID 87762354), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).