C6H7Cl6FO2Si — CID 87762622
fluoro-hydroxy-oxosilane;1,2,3,4,5,6-hexachlorocyclohexane (PubChem CID 87762622) has the molecular formula C6H7Cl6FO2Si and a molecular weight of 370.92 g/mol. Its IUPAC name is fluoro-hydroxy-oxosilane;1,2,3,4,5,6-hexachlorocyclohexane.
| Compound Name | fluoro-hydroxy-oxosilane;1,2,3,4,5,6-hexachlorocyclohexane |
|---|---|
| PubChem CID | 87762622 |
| Molecular Formula | C6H7Cl6FO2Si |
| Molecular Weight | 370.92 g/mol |
| Exact Mass | 367.83 |
| IUPAC Name | fluoro-hydroxy-oxosilane;1,2,3,4,5,6-hexachlorocyclohexane |
| SMILES | ClC1C(Cl)C(Cl)C(Cl)C(Cl)C1Cl.O=[Si](O)F |
| InChI | InChI=1S/C6H6Cl6.FHO2Si/c7-1-2(8)4(10)6(12)5(11)3(1)9;1-4(2)3/h1-6H;2H |
| InChIKey | JZPDQZAAAUWVRW-UHFFFAOYSA-N |
| XLogP | 3.01 |
| TPSA | 37.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 370.92 |
| LogP ≤ 5 | 3.01 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'silicon_halogen', 'substructure': 'N/A'} |
|---|