C26H27F6N3O3 — CID 87763623
(3R,4R)-N-[[3,5-bis(trifluoromethyl)phenyl]methyl]-3-(2-ethylphenyl)-N-methyl-1-oxamoylpiperidine-4-carboxamide (PubChem CID 87763623) has the molecular formula C26H27F6N3O3 and a molecular weight of 543.51 g/mol. Its IUPAC name is (3R,4R)-N-[[3,5-bis(trifluoromethyl)phenyl]methyl]-3-(2-ethylphenyl)-N-methyl-1-oxamoylpiperidine-4-carboxamide.
| Compound Name | (3R,4R)-N-[[3,5-bis(trifluoromethyl)phenyl]methyl]-3-(2-ethylphenyl)-N-methyl-1-oxamoylpiperidine-4-carboxamide |
|---|---|
| PubChem CID | 87763623 |
| Molecular Formula | C26H27F6N3O3 |
| Molecular Weight | 543.51 g/mol |
| Exact Mass | 543.20 |
| IUPAC Name | (3R,4R)-N-[[3,5-bis(trifluoromethyl)phenyl]methyl]-3-(2-ethylphenyl)-N-methyl-1-oxamoylpiperidine-4-carboxamide |
| SMILES | CCc1ccccc1[C@@H]1CN(C(=O)C(N)=O)CC[C@H]1C(=O)N(C)Cc1cc(C(F)(F)F)cc(C(F)(F)F)c1 |
| InChI | InChI=1S/C26H27F6N3O3/c1-3-16-6-4-5-7-19(16)21-14-35(24(38)22(33)36)9-8-20(21)23(37)34(2)13-15-10-17(25(27,28)29)12-18(11-15)26(30,31)32/h4-7,10-12,20-21H,3,8-9,13-14H2,1-2H3,(H2,33,36)/t20-,21+/m1/s1 |
| InChIKey | NTTAQXWHAVXZKN-RTWAWAEBSA-N |
| XLogP | 4.36 |
| TPSA | 83.71 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 38 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 543.51 |
| LogP ≤ 5 | 4.36 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|