About lithium;3-(1-methylpyrrolidin-1-ium-1-yl)propane-1-sulfonate;trifluoromethanesulfonate
lithium;3-(1-methylpyrrolidin-1-ium-1-yl)propane-1-sulfonate;trifluoromethanesulfonate (PubChem CID 87764040) has the molecular formula C9H17F3LiNO6S2
and a molecular weight of 363.31 g/mol. Its IUPAC name is lithium;3-(1-methylpyrrolidin-1-ium-1-yl)propane-1-sulfonate;trifluoromethanesulfonate.
Molecular Properties
| Compound Name | lithium;3-(1-methylpyrrolidin-1-ium-1-yl)propane-1-sulfonate;trifluoromethanesulfonate |
| PubChem CID | 87764040 |
| Molecular Formula | C9H17F3LiNO6S2 |
| Molecular Weight | 363.31 g/mol |
| Exact Mass | 363.06 |
| IUPAC Name | lithium;3-(1-methylpyrrolidin-1-ium-1-yl)propane-1-sulfonate;trifluoromethanesulfonate |
| SMILES | C[N+]1(CCCS(=O)(=O)[O-])CCCC1.O=S(=O)([O-])C(F)(F)F.[Li+] |
| InChI | InChI=1S/C8H17NO3S.CHF3O3S.Li/c1-9(5-2-3-6-9)7-4-8-13(10,11)12;2-1(3,4)8(5,6)7;/h2-8H2,1H3;(H,5,6,7);/q;;+1/p-1 |
| InChIKey | DTLPZLWDVLZEEG-UHFFFAOYSA-M |
| XLogP | -2.78 |
| TPSA | 114.40 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 363.31 |
| LogP ≤ 5 | -2.78 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'}, {'alert_name': 'triflate', 'substructure': 'N/A'} |
|---|
Analyze lithium;3-(1-methylpyrrolidin-1-ium-1-yl)propane-1-sulfonate;trifluoromethanesulfonate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of lithium;3-(1-methylpyrrolidin-1-ium-1-yl)propane-1-sulfonate;trifluoromethanesulfonate?
The IUPAC name of lithium;3-(1-methylpyrrolidin-1-ium-1-yl)propane-1-sulfonate;trifluoromethanesulfonate (CID 87764040) is lithium;3-(1-methylpyrrolidin-1-ium-1-yl)propane-1-sulfonate;trifluoromethanesulfonate.
What is the SMILES notation for lithium;3-(1-methylpyrrolidin-1-ium-1-yl)propane-1-sulfonate;trifluoromethanesulfonate?
The canonical SMILES for lithium;3-(1-methylpyrrolidin-1-ium-1-yl)propane-1-sulfonate;trifluoromethanesulfonate is C[N+]1(CCCS(=O)(=O)[O-])CCCC1.O=S(=O)([O-])C(F)(F)F.[Li+].
What is the InChIKey of lithium;3-(1-methylpyrrolidin-1-ium-1-yl)propane-1-sulfonate;trifluoromethanesulfonate?
The InChIKey is DTLPZLWDVLZEEG-UHFFFAOYSA-M. The full InChI is InChI=1S/C8H17NO3S.CHF3O3S.Li/c1-9(5-2-3-6-9)7-4-8-13(10,11)12;2-1(3,4)8(5,6)7;/h2-8H2,1H3;(H,5,6,7);/q;;+1/p-1.
What are the key properties of lithium;3-(1-methylpyrrolidin-1-ium-1-yl)propane-1-sulfonate;trifluoromethanesulfonate?
lithium;3-(1-methylpyrrolidin-1-ium-1-yl)propane-1-sulfonate;trifluoromethanesulfonate has a molecular weight of 363.31 g/mol, XLogP of -2.78, 4 rotatable bonds, 0 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for lithium;3-(1-methylpyrrolidin-1-ium-1-yl)propane-1-sulfonate;trifluoromethanesulfonate is sourced from PubChem (CID 87764040), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).