C14H17F2NO4S — CID 87764400
4-(2,6-dimethylmorpholin-4-yl)-2,3-difluoro-5-(hydroxymethyl)-6-sulfanylbenzoic acid (PubChem CID 87764400) has the molecular formula C14H17F2NO4S and a molecular weight of 333.36 g/mol. Its IUPAC name is 4-(2,6-dimethylmorpholin-4-yl)-2,3-difluoro-5-(hydroxymethyl)-6-sulfanylbenzoic acid.
| Compound Name | 4-(2,6-dimethylmorpholin-4-yl)-2,3-difluoro-5-(hydroxymethyl)-6-sulfanylbenzoic acid |
|---|---|
| PubChem CID | 87764400 |
| Molecular Formula | C14H17F2NO4S |
| Molecular Weight | 333.36 g/mol |
| Exact Mass | 333.08 |
| IUPAC Name | 4-(2,6-dimethylmorpholin-4-yl)-2,3-difluoro-5-(hydroxymethyl)-6-sulfanylbenzoic acid |
| SMILES | CC1CN(c2c(F)c(F)c(C(=O)O)c(S)c2CO)CC(C)O1 |
| InChI | InChI=1S/C14H17F2NO4S/c1-6-3-17(4-7(2)21-6)12-8(5-18)13(22)9(14(19)20)10(15)11(12)16/h6-7,18,22H,3-5H2,1-2H3,(H,19,20) |
| InChIKey | AAUPXBFXMNIRHD-UHFFFAOYSA-N |
| XLogP | 2.06 |
| TPSA | 70.00 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 333.36 |
| LogP ≤ 5 | 2.06 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|