About 1,1,2-triaminoguanidine;hydrate
1,1,2-triaminoguanidine;hydrate (PubChem CID 87764587) has the molecular formula CH10N6O
and a molecular weight of 122.13 g/mol. Its IUPAC name is 1,1,2-triaminoguanidine;hydrate.
Molecular Properties
| Compound Name | 1,1,2-triaminoguanidine;hydrate |
| PubChem CID | 87764587 |
| Molecular Formula | CH10N6O |
| Molecular Weight | 122.13 g/mol |
| Exact Mass | 122.09 |
| IUPAC Name | 1,1,2-triaminoguanidine;hydrate |
| SMILES | N/N=C(\N)N(N)N.O |
| InChI | InChI=1S/CH8N6.H2O/c2-1(6-3)7(4)5;/h3-5H2,(H2,2,6);1H2 |
| InChIKey | KUIAUENYEOTCHE-UHFFFAOYSA-N |
| XLogP | -3.60 |
| TPSA | 151.18 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | |
| Heavy Atoms | 8 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 122.13 |
| LogP ≤ 5 | -3.60 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze 1,1,2-triaminoguanidine;hydrate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1,1,2-triaminoguanidine;hydrate?
The IUPAC name of 1,1,2-triaminoguanidine;hydrate (CID 87764587) is 1,1,2-triaminoguanidine;hydrate.
What is the SMILES notation for 1,1,2-triaminoguanidine;hydrate?
The canonical SMILES for 1,1,2-triaminoguanidine;hydrate is N/N=C(\N)N(N)N.O.
What is the InChIKey of 1,1,2-triaminoguanidine;hydrate?
The InChIKey is KUIAUENYEOTCHE-UHFFFAOYSA-N. The full InChI is InChI=1S/CH8N6.H2O/c2-1(6-3)7(4)5;/h3-5H2,(H2,2,6);1H2.
What are the key properties of 1,1,2-triaminoguanidine;hydrate?
1,1,2-triaminoguanidine;hydrate has a molecular weight of 122.13 g/mol, XLogP of -3.60, 0 rotatable bonds, 4 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 1,1,2-triaminoguanidine;hydrate is sourced from PubChem (CID 87764587), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).