C20H18F5N3OS — CID 87764880
4-[4-[[4-(1,1,2,2,2-pentafluoroethyl)phenyl]methyl]piperazin-1-yl]-1,3-benzothiazol-6-ol (PubChem CID 87764880) has the molecular formula C20H18F5N3OS and a molecular weight of 443.44 g/mol. Its IUPAC name is 4-[4-[[4-(1,1,2,2,2-pentafluoroethyl)phenyl]methyl]piperazin-1-yl]-1,3-benzothiazol-6-ol.
| Compound Name | 4-[4-[[4-(1,1,2,2,2-pentafluoroethyl)phenyl]methyl]piperazin-1-yl]-1,3-benzothiazol-6-ol |
|---|---|
| PubChem CID | 87764880 |
| Molecular Formula | C20H18F5N3OS |
| Molecular Weight | 443.44 g/mol |
| Exact Mass | 443.11 |
| IUPAC Name | 4-[4-[[4-(1,1,2,2,2-pentafluoroethyl)phenyl]methyl]piperazin-1-yl]-1,3-benzothiazol-6-ol |
| SMILES | Oc1cc(N2CCN(Cc3ccc(C(F)(F)C(F)(F)F)cc3)CC2)c2ncsc2c1 |
| InChI | InChI=1S/C20H18F5N3OS/c21-19(22,20(23,24)25)14-3-1-13(2-4-14)11-27-5-7-28(8-6-27)16-9-15(29)10-17-18(16)26-12-30-17/h1-4,9-10,12,29H,5-8,11H2 |
| InChIKey | YZDQIJAEQBOXGX-UHFFFAOYSA-N |
| XLogP | 4.98 |
| TPSA | 39.60 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 443.44 |
| LogP ≤ 5 | 4.98 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|