About 4-oxo-5-(1,2,2-trimethylcyclopentyl)pent-2-enal
4-oxo-5-(1,2,2-trimethylcyclopentyl)pent-2-enal (PubChem CID 87764980) has the molecular formula C13H20O2
and a molecular weight of 208.30 g/mol. Its IUPAC name is 4-oxo-5-(1,2,2-trimethylcyclopentyl)pent-2-enal.
Molecular Properties
| Compound Name | 4-oxo-5-(1,2,2-trimethylcyclopentyl)pent-2-enal |
| PubChem CID | 87764980 |
| Molecular Formula | C13H20O2 |
| Molecular Weight | 208.30 g/mol |
| Exact Mass | 208.15 |
| IUPAC Name | 4-oxo-5-(1,2,2-trimethylcyclopentyl)pent-2-enal |
| SMILES | CC1(C)CCCC1(C)CC(=O)C=CC=O |
| InChI | InChI=1S/C13H20O2/c1-12(2)7-5-8-13(12,3)10-11(15)6-4-9-14/h4,6,9H,5,7-8,10H2,1-3H3 |
| InChIKey | LMQFIQVUCSOSBN-UHFFFAOYSA-N |
| XLogP | 2.92 |
| TPSA | 34.14 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 208.30 |
| LogP ≤ 5 | 2.92 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|
Analyze 4-oxo-5-(1,2,2-trimethylcyclopentyl)pent-2-enal with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-oxo-5-(1,2,2-trimethylcyclopentyl)pent-2-enal?
The IUPAC name of 4-oxo-5-(1,2,2-trimethylcyclopentyl)pent-2-enal (CID 87764980) is 4-oxo-5-(1,2,2-trimethylcyclopentyl)pent-2-enal.
What is the SMILES notation for 4-oxo-5-(1,2,2-trimethylcyclopentyl)pent-2-enal?
The canonical SMILES for 4-oxo-5-(1,2,2-trimethylcyclopentyl)pent-2-enal is CC1(C)CCCC1(C)CC(=O)C=CC=O.
What is the InChIKey of 4-oxo-5-(1,2,2-trimethylcyclopentyl)pent-2-enal?
The InChIKey is LMQFIQVUCSOSBN-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H20O2/c1-12(2)7-5-8-13(12,3)10-11(15)6-4-9-14/h4,6,9H,5,7-8,10H2,1-3H3.
What are the key properties of 4-oxo-5-(1,2,2-trimethylcyclopentyl)pent-2-enal?
4-oxo-5-(1,2,2-trimethylcyclopentyl)pent-2-enal has a molecular weight of 208.30 g/mol, XLogP of 2.92, 4 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 4-oxo-5-(1,2,2-trimethylcyclopentyl)pent-2-enal is sourced from PubChem (CID 87764980), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).