C25H40O2 — CID 87765279
3-[(5Z,8Z,11Z,14Z,17Z)-icosa-5,8,11,14,17-pentaenoxy]pentan-2-one (PubChem CID 87765279) has the molecular formula C25H40O2 and a molecular weight of 372.59 g/mol. Its IUPAC name is 3-[(5Z,8Z,11Z,14Z,17Z)-icosa-5,8,11,14,17-pentaenoxy]pentan-2-one.
| Compound Name | 3-[(5Z,8Z,11Z,14Z,17Z)-icosa-5,8,11,14,17-pentaenoxy]pentan-2-one |
|---|---|
| PubChem CID | 87765279 |
| Molecular Formula | C25H40O2 |
| Molecular Weight | 372.59 g/mol |
| Exact Mass | 372.30 |
| IUPAC Name | 3-[(5Z,8Z,11Z,14Z,17Z)-icosa-5,8,11,14,17-pentaenoxy]pentan-2-one |
| SMILES | CC/C=C\C/C=C\C/C=C\C/C=C\C/C=C\CCCCOC(CC)C(C)=O |
| InChI | InChI=1S/C25H40O2/c1-4-6-7-8-9-10-11-12-13-14-15-16-17-18-19-20-21-22-23-27-25(5-2)24(3)26/h6-7,9-10,12-13,15-16,18-19,25H,4-5,8,11,14,17,20-23H2,1-3H3/b7-6-,10-9-,13-12-,16-15-,19-18- |
| InChIKey | MZMDALKKMSPCQM-WMPRHZDHSA-N |
| XLogP | 7.29 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 17 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 372.59 |
| LogP ≤ 5 | 7.29 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|