About 2-bromo-3-(1,1-difluoroethyl)-6-(isocyanomethyl)naphthalene
2-bromo-3-(1,1-difluoroethyl)-6-(isocyanomethyl)naphthalene (PubChem CID 87765486) has the molecular formula C14H10BrF2N
and a molecular weight of 310.14 g/mol. Its IUPAC name is 2-bromo-3-(1,1-difluoroethyl)-6-(isocyanomethyl)naphthalene.
Molecular Properties
| Compound Name | 2-bromo-3-(1,1-difluoroethyl)-6-(isocyanomethyl)naphthalene |
| PubChem CID | 87765486 |
| Molecular Formula | C14H10BrF2N |
| Molecular Weight | 310.14 g/mol |
| Exact Mass | 309.00 |
| IUPAC Name | 2-bromo-3-(1,1-difluoroethyl)-6-(isocyanomethyl)naphthalene |
| SMILES | [C-]#[N+]Cc1ccc2cc(Br)c(C(C)(F)F)cc2c1 |
| InChI | InChI=1S/C14H10BrF2N/c1-14(16,17)12-6-11-5-9(8-18-2)3-4-10(11)7-13(12)15/h3-7H,8H2,1H3 |
| InChIKey | ZENRURVIOBBQMN-UHFFFAOYSA-N |
| XLogP | 5.13 |
| TPSA | 4.36 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 310.14 |
| LogP ≤ 5 | 5.13 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'} |
|---|
Analyze 2-bromo-3-(1,1-difluoroethyl)-6-(isocyanomethyl)naphthalene with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-bromo-3-(1,1-difluoroethyl)-6-(isocyanomethyl)naphthalene?
The IUPAC name of 2-bromo-3-(1,1-difluoroethyl)-6-(isocyanomethyl)naphthalene (CID 87765486) is 2-bromo-3-(1,1-difluoroethyl)-6-(isocyanomethyl)naphthalene.
What is the SMILES notation for 2-bromo-3-(1,1-difluoroethyl)-6-(isocyanomethyl)naphthalene?
The canonical SMILES for 2-bromo-3-(1,1-difluoroethyl)-6-(isocyanomethyl)naphthalene is [C-]#[N+]Cc1ccc2cc(Br)c(C(C)(F)F)cc2c1.
What is the InChIKey of 2-bromo-3-(1,1-difluoroethyl)-6-(isocyanomethyl)naphthalene?
The InChIKey is ZENRURVIOBBQMN-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H10BrF2N/c1-14(16,17)12-6-11-5-9(8-18-2)3-4-10(11)7-13(12)15/h3-7H,8H2,1H3.
What are the key properties of 2-bromo-3-(1,1-difluoroethyl)-6-(isocyanomethyl)naphthalene?
2-bromo-3-(1,1-difluoroethyl)-6-(isocyanomethyl)naphthalene has a molecular weight of 310.14 g/mol, XLogP of 5.13, 2 rotatable bonds, 0 hydrogen bond donors, and 0 hydrogen bond acceptors.
Where does this data come from?
All data for 2-bromo-3-(1,1-difluoroethyl)-6-(isocyanomethyl)naphthalene is sourced from PubChem (CID 87765486), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).