C20H17FN2O2 — CID 87765542
(4R,5R)-5-(4-fluorophenyl)-4-[[(1Z)-1-phenylbuta-1,3-dienyl]iminomethyl]-1,3-oxazolidin-2-one (PubChem CID 87765542) has the molecular formula C20H17FN2O2 and a molecular weight of 336.37 g/mol. Its IUPAC name is (4R,5R)-5-(4-fluorophenyl)-4-[[(1Z)-1-phenylbuta-1,3-dienyl]iminomethyl]-1,3-oxazolidin-2-one.
| Compound Name | (4R,5R)-5-(4-fluorophenyl)-4-[[(1Z)-1-phenylbuta-1,3-dienyl]iminomethyl]-1,3-oxazolidin-2-one |
|---|---|
| PubChem CID | 87765542 |
| Molecular Formula | C20H17FN2O2 |
| Molecular Weight | 336.37 g/mol |
| Exact Mass | 336.13 |
| IUPAC Name | (4R,5R)-5-(4-fluorophenyl)-4-[[(1Z)-1-phenylbuta-1,3-dienyl]iminomethyl]-1,3-oxazolidin-2-one |
| SMILES | C=C/C=C(\N=C\[C@H]1NC(=O)O[C@@H]1c1ccc(F)cc1)c1ccccc1 |
| InChI | InChI=1S/C20H17FN2O2/c1-2-6-17(14-7-4-3-5-8-14)22-13-18-19(25-20(24)23-18)15-9-11-16(21)12-10-15/h2-13,18-19H,1H2,(H,23,24)/b17-6-,22-13+/t18-,19-/m1/s1 |
| InChIKey | FURDOFZLBBYVOC-GOJLFWHOSA-N |
| XLogP | 4.27 |
| TPSA | 50.69 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 336.37 |
| LogP ≤ 5 | 4.27 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|