C24H39N3O3 — CID 87766278
benzyl N-[[(1S,2R,4R)-2-butyl-4-(tert-butylamino)cyclohexyl]amino]-N-(2-oxoethyl)carbamate (PubChem CID 87766278) has the molecular formula C24H39N3O3 and a molecular weight of 417.59 g/mol. Its IUPAC name is benzyl N-[[(1S,2R,4R)-2-butyl-4-(tert-butylamino)cyclohexyl]amino]-N-(2-oxoethyl)carbamate.
| Compound Name | benzyl N-[[(1S,2R,4R)-2-butyl-4-(tert-butylamino)cyclohexyl]amino]-N-(2-oxoethyl)carbamate |
|---|---|
| PubChem CID | 87766278 |
| Molecular Formula | C24H39N3O3 |
| Molecular Weight | 417.59 g/mol |
| Exact Mass | 417.30 |
| IUPAC Name | benzyl N-[[(1S,2R,4R)-2-butyl-4-(tert-butylamino)cyclohexyl]amino]-N-(2-oxoethyl)carbamate |
| SMILES | CCCC[C@@H]1C[C@H](NC(C)(C)C)CC[C@@H]1NN(CC=O)C(=O)OCc1ccccc1 |
| InChI | InChI=1S/C24H39N3O3/c1-5-6-12-20-17-21(25-24(2,3)4)13-14-22(20)26-27(15-16-28)23(29)30-18-19-10-8-7-9-11-19/h7-11,16,20-22,25-26H,5-6,12-15,17-18H2,1-4H3/t20-,21-,22+/m1/s1 |
| InChIKey | QXQDEPNKZZUJCK-VSKRKVRLSA-N |
| XLogP | 4.44 |
| TPSA | 70.67 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 417.59 |
| LogP ≤ 5 | 4.44 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|