About bis(1-butyl-3-methylimidazol-3-ium);carbonate
bis(1-butyl-3-methylimidazol-3-ium);carbonate (PubChem CID 87767047) has the molecular formula C17H30N4O3
and a molecular weight of 338.45 g/mol. Its IUPAC name is bis(1-butyl-3-methylimidazol-3-ium);carbonate.
Molecular Properties
| Compound Name | bis(1-butyl-3-methylimidazol-3-ium);carbonate |
| PubChem CID | 87767047 |
| Molecular Formula | C17H30N4O3 |
| Molecular Weight | 338.45 g/mol |
| Exact Mass | 338.23 |
| IUPAC Name | bis(1-butyl-3-methylimidazol-3-ium);carbonate |
| SMILES | CCCCn1cc[n+](C)c1.CCCCn1cc[n+](C)c1.O=C([O-])[O-] |
| InChI | InChI=1S/2C8H15N2.CH2O3/c2*1-3-4-5-10-7-6-9(2)8-10;2-1(3)4/h2*6-8H,3-5H2,1-2H3;(H2,2,3,4)/q2*+1;/p-2 |
| InChIKey | UXZUYRDEITWLLM-UHFFFAOYSA-L |
| XLogP | -0.22 |
| TPSA | 80.81 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 24 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 338.45 |
| LogP ≤ 5 | -0.22 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|
Analyze bis(1-butyl-3-methylimidazol-3-ium);carbonate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of bis(1-butyl-3-methylimidazol-3-ium);carbonate?
The IUPAC name of bis(1-butyl-3-methylimidazol-3-ium);carbonate (CID 87767047) is bis(1-butyl-3-methylimidazol-3-ium);carbonate.
What is the SMILES notation for bis(1-butyl-3-methylimidazol-3-ium);carbonate?
The canonical SMILES for bis(1-butyl-3-methylimidazol-3-ium);carbonate is CCCCn1cc[n+](C)c1.CCCCn1cc[n+](C)c1.O=C([O-])[O-].
What is the InChIKey of bis(1-butyl-3-methylimidazol-3-ium);carbonate?
The InChIKey is UXZUYRDEITWLLM-UHFFFAOYSA-L. The full InChI is InChI=1S/2C8H15N2.CH2O3/c2*1-3-4-5-10-7-6-9(2)8-10;2-1(3)4/h2*6-8H,3-5H2,1-2H3;(H2,2,3,4)/q2*+1;/p-2.
What are the key properties of bis(1-butyl-3-methylimidazol-3-ium);carbonate?
bis(1-butyl-3-methylimidazol-3-ium);carbonate has a molecular weight of 338.45 g/mol, XLogP of -0.22, 6 rotatable bonds, 0 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for bis(1-butyl-3-methylimidazol-3-ium);carbonate is sourced from PubChem (CID 87767047), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).