C25H15F7O4S — CID 87767434
[(2-oxochromen-7-yl)-diphenyl-λ4-sulfanyl] 2,2,3,3,4,4,4-heptafluorobutanoate (PubChem CID 87767434) has the molecular formula C25H15F7O4S and a molecular weight of 544.44 g/mol. Its IUPAC name is [(2-oxochromen-7-yl)-diphenyl-λ4-sulfanyl] 2,2,3,3,4,4,4-heptafluorobutanoate.
| Compound Name | [(2-oxochromen-7-yl)-diphenyl-λ4-sulfanyl] 2,2,3,3,4,4,4-heptafluorobutanoate |
|---|---|
| PubChem CID | 87767434 |
| Molecular Formula | C25H15F7O4S |
| Molecular Weight | 544.44 g/mol |
| Exact Mass | 544.06 |
| IUPAC Name | [(2-oxochromen-7-yl)-diphenyl-λ4-sulfanyl] 2,2,3,3,4,4,4-heptafluorobutanoate |
| SMILES | O=C(OS(c1ccccc1)(c1ccccc1)c1ccc2ccc(=O)oc2c1)C(F)(F)C(F)(F)C(F)(F)F |
| InChI | InChI=1S/C25H15F7O4S/c26-23(27,24(28,29)25(30,31)32)22(34)36-37(17-7-3-1-4-8-17,18-9-5-2-6-10-18)19-13-11-16-12-14-21(33)35-20(16)15-19/h1-15H |
| InChIKey | DADJEQYKYUVGSN-UHFFFAOYSA-N |
| XLogP | 7.37 |
| TPSA | 56.51 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 544.44 |
| LogP ≤ 5 | 7.37 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'cumarine', 'substructure': 'N/A'}, {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|