C29H17F7O3S2 — CID 87767435
[diphenyl-(9-sulfanylidenexanthen-2-yl)-λ4-sulfanyl] 2,2,3,3,4,4,4-heptafluorobutanoate (PubChem CID 87767435) has the molecular formula C29H17F7O3S2 and a molecular weight of 610.57 g/mol. Its IUPAC name is [diphenyl-(9-sulfanylidenexanthen-2-yl)-λ4-sulfanyl] 2,2,3,3,4,4,4-heptafluorobutanoate.
| Compound Name | [diphenyl-(9-sulfanylidenexanthen-2-yl)-λ4-sulfanyl] 2,2,3,3,4,4,4-heptafluorobutanoate |
|---|---|
| PubChem CID | 87767435 |
| Molecular Formula | C29H17F7O3S2 |
| Molecular Weight | 610.57 g/mol |
| Exact Mass | 610.05 |
| IUPAC Name | [diphenyl-(9-sulfanylidenexanthen-2-yl)-λ4-sulfanyl] 2,2,3,3,4,4,4-heptafluorobutanoate |
| SMILES | O=C(OS(c1ccccc1)(c1ccccc1)c1ccc2oc3ccccc3c(=S)c2c1)C(F)(F)C(F)(F)C(F)(F)F |
| InChI | InChI=1S/C29H17F7O3S2/c30-27(31,28(32,33)29(34,35)36)26(37)39-41(18-9-3-1-4-10-18,19-11-5-2-6-12-19)20-15-16-24-22(17-20)25(40)21-13-7-8-14-23(21)38-24/h1-17H |
| InChIKey | LDGUDPLHPMQEJI-UHFFFAOYSA-N |
| XLogP | 9.89 |
| TPSA | 39.44 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 610.57 |
| LogP ≤ 5 | 9.89 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'}, {'alert_name': 'Polycyclic_aromatic_hydrocarbon_2', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|