C11H14O5S2 — CID 87767598
ethyl 2-(2,3-dihydrothieno[3,4-b][1,4]dioxin-3-ylmethoxy)-2-sulfanylacetate (PubChem CID 87767598) has the molecular formula C11H14O5S2 and a molecular weight of 290.36 g/mol. Its IUPAC name is ethyl 2-(2,3-dihydrothieno[3,4-b][1,4]dioxin-3-ylmethoxy)-2-sulfanylacetate.
| Compound Name | ethyl 2-(2,3-dihydrothieno[3,4-b][1,4]dioxin-3-ylmethoxy)-2-sulfanylacetate |
|---|---|
| PubChem CID | 87767598 |
| Molecular Formula | C11H14O5S2 |
| Molecular Weight | 290.36 g/mol |
| Exact Mass | 290.03 |
| IUPAC Name | ethyl 2-(2,3-dihydrothieno[3,4-b][1,4]dioxin-3-ylmethoxy)-2-sulfanylacetate |
| SMILES | CCOC(=O)C(S)OCC1COc2cscc2O1 |
| InChI | InChI=1S/C11H14O5S2/c1-2-13-10(12)11(17)15-4-7-3-14-8-5-18-6-9(8)16-7/h5-7,11,17H,2-4H2,1H3 |
| InChIKey | DIIGHTKOLFYOLG-UHFFFAOYSA-N |
| XLogP | 1.72 |
| TPSA | 53.99 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 290.36 |
| LogP ≤ 5 | 1.72 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|