C7H9N3S2 — CID 87767693
2-N-ethylthieno[2,3-d][1,3]thiazole-2,5-diamine (PubChem CID 87767693) has the molecular formula C7H9N3S2 and a molecular weight of 199.30 g/mol. Its IUPAC name is 2-N-ethylthieno[2,3-d][1,3]thiazole-2,5-diamine.
| Compound Name | 2-N-ethylthieno[2,3-d][1,3]thiazole-2,5-diamine |
|---|---|
| PubChem CID | 87767693 |
| Molecular Formula | C7H9N3S2 |
| Molecular Weight | 199.30 g/mol |
| Exact Mass | 199.02 |
| IUPAC Name | 2-N-ethylthieno[2,3-d][1,3]thiazole-2,5-diamine |
| SMILES | CCNc1nc2sc(N)cc2s1 |
| InChI | InChI=1S/C7H9N3S2/c1-2-9-7-10-6-4(11-7)3-5(8)12-6/h3H,2,8H2,1H3,(H,9,10) |
| InChIKey | OZGNVTKYEXZSHZ-UHFFFAOYSA-N |
| XLogP | 2.37 |
| TPSA | 50.94 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 199.30 |
| LogP ≤ 5 | 2.37 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |