C22H28N4O5 — CID 87767989
(6S,7S)-N-hydroxy-5-methyl-6-[4-(2-methyl-4-nitrophenyl)-1,2,3,6-tetrahydropyridine-2-carbonyl]-5-azaspiro[2.5]octane-7-carboxamide (PubChem CID 87767989) has the molecular formula C22H28N4O5 and a molecular weight of 428.49 g/mol. Its IUPAC name is (6S,7S)-N-hydroxy-5-methyl-6-[4-(2-methyl-4-nitrophenyl)-1,2,3,6-tetrahydropyridine-2-carbonyl]-5-azaspiro[2.5]octane-7-carboxamide.
| Compound Name | (6S,7S)-N-hydroxy-5-methyl-6-[4-(2-methyl-4-nitrophenyl)-1,2,3,6-tetrahydropyridine-2-carbonyl]-5-azaspiro[2.5]octane-7-carboxamide |
|---|---|
| PubChem CID | 87767989 |
| Molecular Formula | C22H28N4O5 |
| Molecular Weight | 428.49 g/mol |
| Exact Mass | 428.21 |
| IUPAC Name | (6S,7S)-N-hydroxy-5-methyl-6-[4-(2-methyl-4-nitrophenyl)-1,2,3,6-tetrahydropyridine-2-carbonyl]-5-azaspiro[2.5]octane-7-carboxamide |
| SMILES | Cc1cc([N+](=O)[O-])ccc1C1=CCNC(C(=O)[C@@H]2[C@@H](C(=O)NO)CC3(CC3)CN2C)C1 |
| InChI | InChI=1S/C22H28N4O5/c1-13-9-15(26(30)31)3-4-16(13)14-5-8-23-18(10-14)20(27)19-17(21(28)24-29)11-22(6-7-22)12-25(19)2/h3-5,9,17-19,23,29H,6-8,10-12H2,1-2H3,(H,24,28)/t17-,18?,19-/m0/s1 |
| InChIKey | XYXZJNJWLVCUPX-JVUMBYKBSA-N |
| XLogP | 1.82 |
| TPSA | 124.81 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 428.49 |
| LogP ≤ 5 | 1.82 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'hydroxamic_acid', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|