C6H7N3OS2 — CID 87768176
6-methoxythieno[2,3-d][1,3]thiazole-2,5-diamine (PubChem CID 87768176) has the molecular formula C6H7N3OS2 and a molecular weight of 201.28 g/mol. Its IUPAC name is 6-methoxythieno[2,3-d][1,3]thiazole-2,5-diamine.
| Compound Name | 6-methoxythieno[2,3-d][1,3]thiazole-2,5-diamine |
|---|---|
| PubChem CID | 87768176 |
| Molecular Formula | C6H7N3OS2 |
| Molecular Weight | 201.28 g/mol |
| Exact Mass | 201.00 |
| IUPAC Name | 6-methoxythieno[2,3-d][1,3]thiazole-2,5-diamine |
| SMILES | COc1c(N)sc2nc(N)sc12 |
| InChI | InChI=1S/C6H7N3OS2/c1-10-2-3-5(12-4(2)7)9-6(8)11-3/h7H2,1H3,(H2,8,9) |
| InChIKey | FSZOHMBJIFVISW-UHFFFAOYSA-N |
| XLogP | 1.53 |
| TPSA | 74.16 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 201.28 |
| LogP ≤ 5 | 1.53 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |