About CID 87768298
CID 87768298 (PubChem CID 87768298) has the molecular formula C2H4KN4
and a molecular weight of 123.18 g/mol.
Molecular Properties
| Compound Name | CID 87768298 |
| PubChem CID | 87768298 |
| Molecular Formula | C2H4KN4 |
| Molecular Weight | 123.18 g/mol |
| Exact Mass | 123.01 |
| IUPAC Name | — |
| SMILES | N#CN=C(N)N.[K] |
| InChI | InChI=1S/C2H4N4.K/c3-1-6-2(4)5;/h(H4,4,5,6); |
| InChIKey | SMROYOHSZLJSON-UHFFFAOYSA-N |
| XLogP | -1.64 |
| TPSA | 88.19 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 7 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 123.18 |
| LogP ≤ 5 | -1.64 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'cyanate_/aminonitrile_/thiocyanate', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|
Analyze CID 87768298 with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of CID 87768298?
The IUPAC name of CID 87768298 (CID 87768298) is not available.
What is the SMILES notation for CID 87768298?
The canonical SMILES for CID 87768298 is N#CN=C(N)N.[K].
What is the InChIKey of CID 87768298?
The InChIKey is SMROYOHSZLJSON-UHFFFAOYSA-N. The full InChI is InChI=1S/C2H4N4.K/c3-1-6-2(4)5;/h(H4,4,5,6);.
What are the key properties of CID 87768298?
CID 87768298 has a molecular weight of 123.18 g/mol, XLogP of -1.64, 0 rotatable bonds, 2 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for CID 87768298 is sourced from PubChem (CID 87768298), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).