C11H15F3N2O4 — CID 87768375
[1,3-dioxol-4-ylmethyl(piperidin-4-yl)amino] 2,2,2-trifluoroacetate (PubChem CID 87768375) has the molecular formula C11H15F3N2O4 and a molecular weight of 296.25 g/mol. Its IUPAC name is [1,3-dioxol-4-ylmethyl(piperidin-4-yl)amino] 2,2,2-trifluoroacetate.
| Compound Name | [1,3-dioxol-4-ylmethyl(piperidin-4-yl)amino] 2,2,2-trifluoroacetate |
|---|---|
| PubChem CID | 87768375 |
| Molecular Formula | C11H15F3N2O4 |
| Molecular Weight | 296.25 g/mol |
| Exact Mass | 296.10 |
| IUPAC Name | [1,3-dioxol-4-ylmethyl(piperidin-4-yl)amino] 2,2,2-trifluoroacetate |
| SMILES | O=C(ON(CC1=COCO1)C1CCNCC1)C(F)(F)F |
| InChI | InChI=1S/C11H15F3N2O4/c12-11(13,14)10(17)20-16(5-9-6-18-7-19-9)8-1-3-15-4-2-8/h6,8,15H,1-5,7H2 |
| InChIKey | RTOZVIBKSKBGLY-UHFFFAOYSA-N |
| XLogP | 0.91 |
| TPSA | 60.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 296.25 |
| LogP ≤ 5 | 0.91 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|