C25H58N2O — CID 87768576
bis(N,N-dipropylpropan-1-amine);heptan-1-ol (PubChem CID 87768576) has the molecular formula C25H58N2O and a molecular weight of 402.75 g/mol. Its IUPAC name is bis(N,N-dipropylpropan-1-amine);heptan-1-ol.
| Compound Name | bis(N,N-dipropylpropan-1-amine);heptan-1-ol |
|---|---|
| PubChem CID | 87768576 |
| Molecular Formula | C25H58N2O |
| Molecular Weight | 402.75 g/mol |
| Exact Mass | 402.45 |
| IUPAC Name | bis(N,N-dipropylpropan-1-amine);heptan-1-ol |
| SMILES | CCCCCCCO.CCCN(CCC)CCC.CCCN(CCC)CCC |
| InChI | InChI=1S/2C9H21N.C7H16O/c2*1-4-7-10(8-5-2)9-6-3;1-2-3-4-5-6-7-8/h2*4-9H2,1-3H3;8H,2-7H2,1H3 |
| InChIKey | GBGHYIOYVVEJAB-UHFFFAOYSA-N |
| XLogP | 6.99 |
| TPSA | 26.71 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 17 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 402.75 |
| LogP ≤ 5 | 6.99 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|